C11H16ClN — CID 169448943
3,3,5-trimethyl-1,2-dihydroindole;hydrochloride (PubChem CID 169448943) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 3,3,5-trimethyl-1,2-dihydroindole;hydrochloride.
| Compound Name | 3,3,5-trimethyl-1,2-dihydroindole;hydrochloride |
|---|---|
| PubChem CID | 169448943 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3,3,5-trimethyl-1,2-dihydroindole;hydrochloride |
| SMILES | Cc1ccc2c(c1)C(C)(C)CN2.Cl |
| InChI | InChI=1S/C11H15N.ClH/c1-8-4-5-10-9(6-8)11(2,3)7-12-10;/h4-6,12H,7H2,1-3H3;1H |
| InChIKey | FJNNEOXNCBGXGP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |