About 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one
2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one (PubChem CID 169449454) has the molecular formula C14H14N6O2
and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one |
| PubChem CID | 169449454 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one |
| SMILES | CC(CC(=O)c1cccnc1)Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N6O2/c1-8(5-10(21)9-3-2-4-15-6-9)18-14-19-12-11(13(22)20-14)16-7-17-12/h2-4,6-8H,5H2,1H3,(H3,16,17,18,19,20,22) |
| InChIKey | ZRTCQAZIZKKDPE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one?
The IUPAC name of 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one (CID 169449454) is 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one?
The canonical SMILES for 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one is CC(CC(=O)c1cccnc1)Nc1nc2nc[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one?
The InChIKey is ZRTCQAZIZKKDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6O2/c1-8(5-10(21)9-3-2-4-15-6-9)18-14-19-12-11(13(22)20-14)16-7-17-12/h2-4,6-8H,5H2,1H3,(H3,16,17,18,19,20,22).
What are the key properties of 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one?
2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one has a molecular weight of 298.31 g/mol, XLogP of 1.11, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-oxo-4-pyridin-3-ylbutan-2-yl)amino]-1,7-dihydropurin-6-one is sourced from PubChem (CID 169449454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).