C15H32N2O2+ — CID 169449560
2,2,6,6-Tetramethyl-4-[3-(trimethylammonio)propoxy]-1-piperidinyloxy (PubChem CID 169449560) has the molecular formula C15H32N2O2+ and a molecular weight of 272.43 g/mol.
| Compound Name | 2,2,6,6-Tetramethyl-4-[3-(trimethylammonio)propoxy]-1-piperidinyloxy |
|---|---|
| PubChem CID | 169449560 |
| Molecular Formula | C15H32N2O2+ |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OCCC[N+](C)(C)C)CC(C)(C)N1[O] |
| InChI | InChI=1S/C15H32N2O2/c1-14(2)11-13(12-15(3,4)16(14)18)19-10-8-9-17(5,6)7/h13H,8-12H2,1-7H3/q+1 |
| InChIKey | HMXMXARTEKVDLC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|