C17H13F3O5 — CID 169449761
3-ethoxycarbonyl-2-[4-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 169449761) has the molecular formula C17H13F3O5 and a molecular weight of 354.28 g/mol. Its IUPAC name is 3-ethoxycarbonyl-2-[4-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 3-ethoxycarbonyl-2-[4-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 169449761 |
| Molecular Formula | C17H13F3O5 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-ethoxycarbonyl-2-[4-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | CCOC(=O)c1cccc(C(=O)O)c1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3O5/c1-2-24-16(23)13-5-3-4-12(15(21)22)14(13)10-6-8-11(9-7-10)25-17(18,19)20/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | AUVNBRHNDOTYFU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |