C27H49O11- — CID 169452173
(1R,3S,4R,7S,9S,11S,13R,14S,15R)-4,11,13,14-tetrahydroxy-7-[(4R)-4-(hydroxymethyl)hexan-2-yl]-3,9,15-trimethoxy-12,12-dimethyl-6,17-dioxabicyclo[11.3.1]heptadecan-5-one (PubChem CID 169452173) has the molecular formula C27H49O11- and a molecular weight of 549.68 g/mol. Its IUPAC name is (1R,3S,4R,7S,9S,11S,13R,14S,15R)-4,11,13,14-tetrahydroxy-7-[(4R)-4-(hydroxymethyl)hexan-2-yl]-3,9,15-trimethoxy-12,12-dimethyl-6,17-dioxabicyclo[11.3.1]heptadecan-5-one.
| Compound Name | (1R,3S,4R,7S,9S,11S,13R,14S,15R)-4,11,13,14-tetrahydroxy-7-[(4R)-4-(hydroxymethyl)hexan-2-yl]-3,9,15-trimethoxy-12,12-dimethyl-6,17-dioxabicyclo[11.3.1]heptadecan-5-one |
|---|---|
| PubChem CID | 169452173 |
| Molecular Formula | C27H49O11- |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (1R,3S,4R,7S,9S,11S,13R,14S,15R)-4,11,13,14-tetrahydroxy-7-[(4R)-4-(hydroxymethyl)hexan-2-yl]-3,9,15-trimethoxy-12,12-dimethyl-6,17-dioxabicyclo[11.3.1]heptadecan-5-one |
| SMILES | CC[C@@H]([CH-]C(C)[C@@H]1C[C@@H](OC)C[C@H](O)C(C)(C)[C@@]2(O)O[C@@H](C[C@H](OC)[C@@H](O)C(=O)O1)C[C@@H](OC)[C@@H]2O)CO |
| InChI | InChI=1S/C27H49O11/c1-8-16(14-28)9-15(2)19-10-17(34-5)13-22(29)26(3,4)27(33)24(31)21(36-7)12-18(38-27)11-20(35-6)23(30)25(32)37-19/h9,15-24,28-31,33H,8,10-14H2,1-7H3/q-1/t15?,16-,17+,18-,19-,20-,21+,22-,23+,24-,27-/m0/s1 |
| InChIKey | CDKISWMSKFUXSQ-DPPYVRGRSA-N |
| XLogP | 0.57 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|