C21H30N4O4 — CID 169452178
3-[2-[3-(2,4-diamino-6-pentylpyrimidin-5-yl)oxypropoxy]phenyl]propanoic acid (PubChem CID 169452178) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[2-[3-(2,4-diamino-6-pentylpyrimidin-5-yl)oxypropoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[3-(2,4-diamino-6-pentylpyrimidin-5-yl)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 169452178 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3-[2-[3-(2,4-diamino-6-pentylpyrimidin-5-yl)oxypropoxy]phenyl]propanoic acid |
| SMILES | CCCCCc1nc(N)nc(N)c1OCCCOc1ccccc1CCC(=O)O |
| InChI | InChI=1S/C21H30N4O4/c1-2-3-4-9-16-19(20(22)25-21(23)24-16)29-14-7-13-28-17-10-6-5-8-15(17)11-12-18(26)27/h5-6,8,10H,2-4,7,9,11-14H2,1H3,(H,26,27)(H4,22,23,24,25) |
| InChIKey | DLJJCGFJECSXLF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|