About 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid
3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid (PubChem CID 169452182) has the molecular formula C23H23F3N4O4
and a molecular weight of 476.46 g/mol. Its IUPAC name is 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid |
| PubChem CID | 169452182 |
| Molecular Formula | C23H23F3N4O4 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid |
| SMILES | Nc1nc(N)c(OCCCOc2ccccc2CCC(=O)O)c(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C23H23F3N4O4/c24-23(25,26)16-8-3-2-7-15(16)19-20(21(27)30-22(28)29-19)34-13-5-12-33-17-9-4-1-6-14(17)10-11-18(31)32/h1-4,6-9H,5,10-13H2,(H,31,32)(H4,27,28,29,30) |
| InChIKey | OUIRZIUAXRLDKD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid?
The IUPAC name of 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid (CID 169452182) is 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid is Nc1nc(N)c(OCCCOc2ccccc2CCC(=O)O)c(-c2ccccc2C(F)(F)F)n1.
What is the InChIKey of 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid?
The InChIKey is OUIRZIUAXRLDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F3N4O4/c24-23(25,26)16-8-3-2-7-15(16)19-20(21(27)30-22(28)29-19)34-13-5-12-33-17-9-4-1-6-14(17)10-11-18(31)32/h1-4,6-9H,5,10-13H2,(H,31,32)(H4,27,28,29,30).
What are the key properties of 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid?
3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid has a molecular weight of 476.46 g/mol, XLogP of 4.19, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3-[2,4-diamino-6-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]oxypropoxy]phenyl]propanoic acid is sourced from PubChem (CID 169452182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).