C15H13FN4O — CID 169452185
5-fluoro-2-[[[3-(1H-imidazol-5-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 169452185) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1H-imidazol-5-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(1H-imidazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 169452185 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-fluoro-2-[[[3-(1H-imidazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1cnc[nH]1 |
| InChI | InChI=1S/C15H13FN4O/c16-11-4-3-10(14(21)6-11)7-19-15-12(2-1-5-18-15)13-8-17-9-20-13/h1-6,8-9,21H,7H2,(H,17,20)(H,18,19) |
| InChIKey | GOBKDOPCDPTXFF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|