About 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol
5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 169452186) has the molecular formula C15H12FN3O2
and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol |
| PubChem CID | 169452186 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1cocn1 |
| InChI | InChI=1S/C15H12FN3O2/c16-11-4-3-10(14(20)6-11)7-18-15-12(2-1-5-17-15)13-8-21-9-19-13/h1-6,8-9,20H,7H2,(H,17,18) |
| InChIKey | AIPASLMZJHFYBT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol?
The IUPAC name of 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol (CID 169452186) is 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol.
What is the SMILES notation for 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol?
The canonical SMILES for 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol is Oc1cc(F)ccc1CNc1ncccc1-c1cocn1.
What is the InChIKey of 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol?
The InChIKey is AIPASLMZJHFYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O2/c16-11-4-3-10(14(20)6-11)7-18-15-12(2-1-5-17-15)13-8-21-9-19-13/h1-6,8-9,20H,7H2,(H,17,18).
What are the key properties of 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol?
5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol has a molecular weight of 285.28 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[[[3-(1,3-oxazol-4-yl)-2-pyridinyl]amino]methyl]phenol is sourced from PubChem (CID 169452186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).