C20H23NO — CID 169452309
3-methyl-8-(1,3,3-trimethylindol-2-ylidene)octa-2,4,6-trienal (PubChem CID 169452309) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-methyl-8-(1,3,3-trimethylindol-2-ylidene)octa-2,4,6-trienal.
| Compound Name | 3-methyl-8-(1,3,3-trimethylindol-2-ylidene)octa-2,4,6-trienal |
|---|---|
| PubChem CID | 169452309 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-methyl-8-(1,3,3-trimethylindol-2-ylidene)octa-2,4,6-trienal |
| SMILES | CC(C=CC=CC=C1N(C)c2ccccc2C1(C)C)=CC=O |
| InChI | InChI=1S/C20H23NO/c1-16(14-15-22)10-6-5-7-13-19-20(2,3)17-11-8-9-12-18(17)21(19)4/h5-15H,1-4H3 |
| InChIKey | CZRYDQYFWQWGJM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|