C18H11ClN4O3S — CID 169452340
1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione (PubChem CID 169452340) has the molecular formula C18H11ClN4O3S and a molecular weight of 398.83 g/mol. Its IUPAC name is 1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione.
| Compound Name | 1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione |
|---|---|
| PubChem CID | 169452340 |
| Molecular Formula | C18H11ClN4O3S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C(=O)CSc2n[nH]c(-c3ccccc3Cl)n2)c2ccccc21 |
| InChI | InChI=1S/C18H11ClN4O3S/c19-12-7-3-1-5-10(12)16-20-18(22-21-16)27-9-14(24)23-13-8-4-2-6-11(13)15(25)17(23)26/h1-8H,9H2,(H,20,21,22) |
| InChIKey | JKCXLTMACFZHBW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|