C18H10Cl2N4O3S — CID 169452355
5-chloro-1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione (PubChem CID 169452355) has the molecular formula C18H10Cl2N4O3S and a molecular weight of 433.28 g/mol. Its IUPAC name is 5-chloro-1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione |
|---|---|
| PubChem CID | 169452355 |
| Molecular Formula | C18H10Cl2N4O3S |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 5-chloro-1-[2-[[5-(2-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C(=O)CSc2n[nH]c(-c3ccccc3Cl)n2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H10Cl2N4O3S/c19-9-5-6-13-11(7-9)15(26)17(27)24(13)14(25)8-28-18-21-16(22-23-18)10-3-1-2-4-12(10)20/h1-7H,8H2,(H,21,22,23) |
| InChIKey | BLQBTHYDZLKRAW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|