About (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide
(3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 169452756) has the molecular formula C8H8N2O4S
and a molecular weight of 228.23 g/mol. Its IUPAC name is (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide |
| PubChem CID | 169452756 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@H](O)C(=O)N2 |
| InChI | InChI=1S/C8H8N2O4S/c9-15(13,14)4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3,7,11H,(H,10,12)(H2,9,13,14)/t7-/m0/s1 |
| InChIKey | KJMQFACDQCJBET-ZETCQYMHSA-N |
| XLogP | -0.68 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide?
The IUPAC name of (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide (CID 169452756) is (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide.
What is the SMILES notation for (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide?
The canonical SMILES for (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide is NS(=O)(=O)c1ccc2c(c1)[C@H](O)C(=O)N2.
What is the InChIKey of (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide?
The InChIKey is KJMQFACDQCJBET-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H8N2O4S/c9-15(13,14)4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3,7,11H,(H,10,12)(H2,9,13,14)/t7-/m0/s1.
What are the key properties of (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide?
(3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide has a molecular weight of 228.23 g/mol, XLogP of -0.68, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-2-oxo-1,3-dihydroindole-5-sulfonamide is sourced from PubChem (CID 169452756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).