C12H15NO — CID 169453485
3-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-en-1-ol (PubChem CID 169453485) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-en-1-ol.
| Compound Name | 3-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 169453485 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-en-1-ol |
| SMILES | OCC=Cc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C12H15NO/c14-7-1-2-10-3-4-11-5-6-13-9-12(11)8-10/h1-4,8,13-14H,5-7,9H2 |
| InChIKey | CGHOVQSGSXPTFA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |