C23H22ClN3O4S — CID 16945465
2-[(4-chlorobenzoyl)amino]-N-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 16945465) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-N-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-N-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 16945465 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-N-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCc3sc(NC(=O)c4ccc(Cl)cc4)nc32)cc1OC |
| InChI | InChI=1S/C23H22ClN3O4S/c1-30-17-11-10-15(12-18(17)31-2)25-22(29)16-4-3-5-19-20(16)26-23(32-19)27-21(28)13-6-8-14(24)9-7-13/h6-12,16H,3-5H2,1-2H3,(H,25,29)(H,26,27,28) |
| InChIKey | QCZXJNSZBREVFL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |