C9H7Cl3S — CID 169454946
3-(2,3,5-trichlorophenyl)prop-2-ene-1-thiol (PubChem CID 169454946) has the molecular formula C9H7Cl3S and a molecular weight of 253.58 g/mol. Its IUPAC name is 3-(2,3,5-trichlorophenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(2,3,5-trichlorophenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169454946 |
| Molecular Formula | C9H7Cl3S |
| Molecular Weight | 253.58 g/mol |
| Exact Mass | 251.93 |
| IUPAC Name | 3-(2,3,5-trichlorophenyl)prop-2-ene-1-thiol |
| SMILES | SCC=Cc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl3S/c10-7-4-6(2-1-3-13)9(12)8(11)5-7/h1-2,4-5,13H,3H2 |
| InChIKey | ZIJMHHUINCGFKE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|