C15H17NS — CID 169456122
3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)prop-2-ene-1-thiol (PubChem CID 169456122) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169456122 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)prop-2-ene-1-thiol |
| SMILES | SCC=Cc1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C15H17NS/c17-9-3-4-11-7-8-15-13(10-11)12-5-1-2-6-14(12)16-15/h3-4,7-8,10,16-17H,1-2,5-6,9H2 |
| InChIKey | YBFGAQZTTUGMCV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|