C9H10ClN3OS — CID 169456984
S-[3-(3-amino-5-chloropyrazin-2-yl)prop-2-enyl] ethanethioate (PubChem CID 169456984) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is S-[3-(3-amino-5-chloropyrazin-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3-amino-5-chloropyrazin-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456984 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | S-[3-(3-amino-5-chloropyrazin-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ncc(Cl)nc1N |
| InChI | InChI=1S/C9H10ClN3OS/c1-6(14)15-4-2-3-7-9(11)13-8(10)5-12-7/h2-3,5H,4H2,1H3,(H2,11,13) |
| InChIKey | ZRGKWIZMLVTFIA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|