About 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid
5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 169458870) has the molecular formula C7H5NO3S
and a molecular weight of 183.19 g/mol. Its IUPAC name is 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 169458870 |
| Molecular Formula | C7H5NO3S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=CC=Cc1scnc1C(=O)O |
| InChI | InChI=1S/C7H5NO3S/c9-3-1-2-5-6(7(10)11)8-4-12-5/h1-4H,(H,10,11) |
| InChIKey | RANARUQDXOYWCD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid (CID 169458870) is 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid is O=CC=Cc1scnc1C(=O)O.
What is the InChIKey of 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is RANARUQDXOYWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c9-3-1-2-5-6(7(10)11)8-4-12-5/h1-4H,(H,10,11).
What are the key properties of 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 183.19 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-oxoprop-1-enyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 169458870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).