C24H23N3O4S — CID 16945942
2-(1,3-benzodioxole-5-carbonylamino)-N-(2,6-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 16945942) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-(1,3-benzodioxole-5-carbonylamino)-N-(2,6-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxole-5-carbonylamino)-N-(2,6-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 16945942 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-(1,3-benzodioxole-5-carbonylamino)-N-(2,6-dimethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCc2sc(NC(=O)c3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C24H23N3O4S/c1-13-5-3-6-14(2)20(13)25-23(29)16-7-4-8-19-21(16)26-24(32-19)27-22(28)15-9-10-17-18(11-15)31-12-30-17/h3,5-6,9-11,16H,4,7-8,12H2,1-2H3,(H,25,29)(H,26,27,28) |
| InChIKey | LGCQZKFGNDCLBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |