C9H5Cl3O — CID 169460091
3-(2,3,6-trichlorophenyl)prop-2-enal (PubChem CID 169460091) has the molecular formula C9H5Cl3O and a molecular weight of 235.50 g/mol. Its IUPAC name is 3-(2,3,6-trichlorophenyl)prop-2-enal.
| Compound Name | 3-(2,3,6-trichlorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 169460091 |
| Molecular Formula | C9H5Cl3O |
| Molecular Weight | 235.50 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 3-(2,3,6-trichlorophenyl)prop-2-enal |
| SMILES | O=CC=Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl3O/c10-7-3-4-8(11)9(12)6(7)2-1-5-13/h1-5H |
| InChIKey | UOXPUXCLLAHGKS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|