About 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal
3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal (PubChem CID 169460217) has the molecular formula C7H5Cl2N3O
and a molecular weight of 218.04 g/mol. Its IUPAC name is 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal.
Molecular Properties
| Compound Name | 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal |
| PubChem CID | 169460217 |
| Molecular Formula | C7H5Cl2N3O |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 216.98 |
| IUPAC Name | 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal |
| SMILES | Nc1nc(Cl)c(C=CC=O)c(Cl)n1 |
| InChI | InChI=1S/C7H5Cl2N3O/c8-5-4(2-1-3-13)6(9)12-7(10)11-5/h1-3H,(H2,10,11,12) |
| InChIKey | NXMJFYTUKQBQFP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal?
The IUPAC name of 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal (CID 169460217) is 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal.
What is the SMILES notation for 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal?
The canonical SMILES for 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal is Nc1nc(Cl)c(C=CC=O)c(Cl)n1.
What is the InChIKey of 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal?
The InChIKey is NXMJFYTUKQBQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3O/c8-5-4(2-1-3-13)6(9)12-7(10)11-5/h1-3H,(H2,10,11,12).
What are the key properties of 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal?
3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal has a molecular weight of 218.04 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4,6-dichloropyrimidin-5-yl)prop-2-enal is sourced from PubChem (CID 169460217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).