C10H11NO3 — CID 169460544
3-(6-methoxy-5-methyl-3-pyridinyl)prop-2-enoic acid (PubChem CID 169460544) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-(6-methoxy-5-methyl-3-pyridinyl)prop-2-enoic acid.
| Compound Name | 3-(6-methoxy-5-methyl-3-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 169460544 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(6-methoxy-5-methyl-3-pyridinyl)prop-2-enoic acid |
| SMILES | COc1ncc(C=CC(=O)O)cc1C |
| InChI | InChI=1S/C10H11NO3/c1-7-5-8(3-4-9(12)13)6-11-10(7)14-2/h3-6H,1-2H3,(H,12,13) |
| InChIKey | LSHVNTFPSSBMSZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|