C8H6Cl2N2O2S — CID 169461203
3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid (PubChem CID 169461203) has the molecular formula C8H6Cl2N2O2S and a molecular weight of 265.12 g/mol. Its IUPAC name is 3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid.
| Compound Name | 3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 169461203 |
| Molecular Formula | C8H6Cl2N2O2S |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | 3-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid |
| SMILES | CSc1nc(Cl)c(C=CC(=O)O)c(Cl)n1 |
| InChI | InChI=1S/C8H6Cl2N2O2S/c1-15-8-11-6(9)4(7(10)12-8)2-3-5(13)14/h2-3H,1H3,(H,13,14) |
| InChIKey | FUNKNSFHEVXOMU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|