C9H7F2N3O — CID 169461687
4-(3-azidoprop-1-enyl)-2,3-difluorophenol (PubChem CID 169461687) has the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)-2,3-difluorophenol.
| Compound Name | 4-(3-azidoprop-1-enyl)-2,3-difluorophenol |
|---|---|
| PubChem CID | 169461687 |
| Molecular Formula | C9H7F2N3O |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)-2,3-difluorophenol |
| SMILES | [N-]=[N+]=NCC=Cc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C9H7F2N3O/c10-8-6(2-1-5-13-14-12)3-4-7(15)9(8)11/h1-4,15H,5H2 |
| InChIKey | QEIUKTNTFSXGFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|