About 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one
5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one (PubChem CID 169461900) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one |
| PubChem CID | 169461900 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one |
| SMILES | [N-]=[N+]=NCC=Cc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C12H11N3O/c13-15-14-7-1-2-9-3-5-11-10(8-9)4-6-12(11)16/h1-3,5,8H,4,6-7H2 |
| InChIKey | YZTYJPPGTFYMPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one?
The IUPAC name of 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one (CID 169461900) is 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one?
The canonical SMILES for 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one is [N-]=[N+]=NCC=Cc1ccc2c(c1)CCC2=O.
What is the InChIKey of 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one?
The InChIKey is YZTYJPPGTFYMPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c13-15-14-7-1-2-9-3-5-11-10(8-9)4-6-12(11)16/h1-3,5,8H,4,6-7H2.
What are the key properties of 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one?
5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one has a molecular weight of 213.24 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-azidoprop-1-enyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 169461900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).