About 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine
4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine (PubChem CID 169461904) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 169461904 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine |
| SMILES | [N-]=[N+]=NCC=Cc1cccc2sc(N)nc12 |
| InChI | InChI=1S/C10H9N5S/c11-10-14-9-7(4-2-6-13-15-12)3-1-5-8(9)16-10/h1-5H,6H2,(H2,11,14) |
| InChIKey | LTIMNJITMYSWGZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine?
The IUPAC name of 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine (CID 169461904) is 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine is [N-]=[N+]=NCC=Cc1cccc2sc(N)nc12.
What is the InChIKey of 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine?
The InChIKey is LTIMNJITMYSWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c11-10-14-9-7(4-2-6-13-15-12)3-1-5-8(9)16-10/h1-5H,6H2,(H2,11,14).
What are the key properties of 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine?
4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine has a molecular weight of 231.28 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-azidoprop-1-enyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 169461904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).