About 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one
6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 169461911) has the molecular formula C9H7N5O2
and a molecular weight of 217.19 g/mol. Its IUPAC name is 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 169461911 |
| Molecular Formula | C9H7N5O2 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | [N-]=[N+]=NCC=Cc1cnc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H7N5O2/c10-14-12-3-1-2-6-4-7-8(11-5-6)13-9(15)16-7/h1-2,4-5H,3H2,(H,11,13,15) |
| InChIKey | YPIWZJIUWUZYFB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 169461911) is 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is [N-]=[N+]=NCC=Cc1cnc2[nH]c(=O)oc2c1.
What is the InChIKey of 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is YPIWZJIUWUZYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5O2/c10-14-12-3-1-2-6-4-7-8(11-5-6)13-9(15)16-7/h1-2,4-5H,3H2,(H,11,13,15).
What are the key properties of 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 217.19 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-azidoprop-1-enyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 169461911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).