C9H6F2N4O2 — CID 169462362
1-(3-azidoprop-1-enyl)-3,5-difluoro-2-nitrobenzene (PubChem CID 169462362) has the molecular formula C9H6F2N4O2 and a molecular weight of 240.17 g/mol. Its IUPAC name is 1-(3-azidoprop-1-enyl)-3,5-difluoro-2-nitrobenzene.
| Compound Name | 1-(3-azidoprop-1-enyl)-3,5-difluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 169462362 |
| Molecular Formula | C9H6F2N4O2 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-(3-azidoprop-1-enyl)-3,5-difluoro-2-nitrobenzene |
| SMILES | [N-]=[N+]=NCC=Cc1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6F2N4O2/c10-7-4-6(2-1-3-13-14-12)9(15(16)17)8(11)5-7/h1-2,4-5H,3H2 |
| InChIKey | OECDZVLEVXJCIR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|