About 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid
5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 169463339) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 169463339 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | NCC=Cc1scnc1C(=O)O |
| InChI | InChI=1S/C7H8N2O2S/c8-3-1-2-5-6(7(10)11)9-4-12-5/h1-2,4H,3,8H2,(H,10,11) |
| InChIKey | YFTPOTWKFOZZBS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid (CID 169463339) is 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid is NCC=Cc1scnc1C(=O)O.
What is the InChIKey of 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is YFTPOTWKFOZZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c8-3-1-2-5-6(7(10)11)9-4-12-5/h1-2,4H,3,8H2,(H,10,11).
What are the key properties of 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid?
5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 184.22 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminoprop-1-enyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 169463339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).