C12H11F2NO3 — CID 169466002
4-(3-acetamidoprop-1-enyl)-2,5-difluorobenzoic acid (PubChem CID 169466002) has the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. Its IUPAC name is 4-(3-acetamidoprop-1-enyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(3-acetamidoprop-1-enyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 169466002 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-(3-acetamidoprop-1-enyl)-2,5-difluorobenzoic acid |
| SMILES | CC(=O)NCC=Cc1cc(F)c(C(=O)O)cc1F |
| InChI | InChI=1S/C12H11F2NO3/c1-7(16)15-4-2-3-8-5-11(14)9(12(17)18)6-10(8)13/h2-3,5-6H,4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | DZTJOLVGPFAGDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |