C12H17N3O4 — CID 169467166
tert-butyl N-[3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)prop-2-enyl]carbamate (PubChem CID 169467166) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is tert-butyl N-[3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467166 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | tert-butyl N-[3-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C12H17N3O4/c1-12(2,3)19-11(18)13-6-4-5-8-9(16)14-7-15-10(8)17/h4-5,7H,6H2,1-3H3,(H,13,18)(H2,14,15,16,17) |
| InChIKey | VGNJFHIPYVTSMM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |