C14H17F3N2O2 — CID 169467876
tert-butyl N-[3-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enyl]carbamate (PubChem CID 169467876) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is tert-butyl N-[3-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467876 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | tert-butyl N-[3-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-13(2,3)21-12(20)18-8-4-5-10-6-7-11(19-9-10)14(15,16)17/h4-7,9H,8H2,1-3H3,(H,18,20) |
| InChIKey | HJUIFBJSWDYKIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |