C18H25N3O2 — CID 169468745
tert-butyl N-[3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enyl]carbamate (PubChem CID 169468745) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468745 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl N-[3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enyl]carbamate |
| SMILES | CN(CCC#N)c1ccc(C=CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)23-17(22)20-13-5-7-15-8-10-16(11-9-15)21(4)14-6-12-19/h5,7-11H,6,13-14H2,1-4H3,(H,20,22) |
| InChIKey | ZPEGZOVMWGHUHG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|