C18H16N2O3 — CID 169471696
benzyl N-[3-(3-cyano-4-hydroxyphenyl)prop-2-enyl]carbamate (PubChem CID 169471696) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is benzyl N-[3-(3-cyano-4-hydroxyphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-cyano-4-hydroxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471696 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | benzyl N-[3-(3-cyano-4-hydroxyphenyl)prop-2-enyl]carbamate |
| SMILES | N#Cc1cc(C=CCNC(=O)OCc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H16N2O3/c19-12-16-11-14(8-9-17(16)21)7-4-10-20-18(22)23-13-15-5-2-1-3-6-15/h1-9,11,21H,10,13H2,(H,20,22) |
| InChIKey | FFOFJGZVWAJYBU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |