C17H15FN2O4 — CID 169472031
benzyl N-[3-(4-fluoro-2-nitrophenyl)prop-2-enyl]carbamate (PubChem CID 169472031) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is benzyl N-[3-(4-fluoro-2-nitrophenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-fluoro-2-nitrophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472031 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | benzyl N-[3-(4-fluoro-2-nitrophenyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(F)cc1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O4/c18-15-9-8-14(16(11-15)20(22)23)7-4-10-19-17(21)24-12-13-5-2-1-3-6-13/h1-9,11H,10,12H2,(H,19,21) |
| InChIKey | WQEHIJCNJSULNW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|