C20H23NO4 — CID 169472836
benzyl N-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enyl]carbamate (PubChem CID 169472836) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is benzyl N-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472836 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | benzyl N-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enyl]carbamate |
| SMILES | CCOc1ccc(C=CCNC(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H23NO4/c1-3-24-18-12-11-16(14-19(18)23-2)10-7-13-21-20(22)25-15-17-8-5-4-6-9-17/h4-12,14H,3,13,15H2,1-2H3,(H,21,22) |
| InChIKey | SJOWBYIFVPFYLM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |