C12H15NO3 — CID 169474148
5-methoxy-2-[3-(methylamino)prop-1-enyl]benzoic acid (PubChem CID 169474148) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-methoxy-2-[3-(methylamino)prop-1-enyl]benzoic acid.
| Compound Name | 5-methoxy-2-[3-(methylamino)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 169474148 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5-methoxy-2-[3-(methylamino)prop-1-enyl]benzoic acid |
| SMILES | CNCC=Cc1ccc(OC)cc1C(=O)O |
| InChI | InChI=1S/C12H15NO3/c1-13-7-3-4-9-5-6-10(16-2)8-11(9)12(14)15/h3-6,8,13H,7H2,1-2H3,(H,14,15) |
| InChIKey | OCXKRMZQPLDWCS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |