About 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene
5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene (PubChem CID 169477157) has the molecular formula C11H12ClF
and a molecular weight of 198.67 g/mol. Its IUPAC name is 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene |
| PubChem CID | 169477157 |
| Molecular Formula | C11H12ClF |
| Molecular Weight | 198.67 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(C=CCCl)cc(C)c1F |
| InChI | InChI=1S/C11H12ClF/c1-8-6-10(4-3-5-12)7-9(2)11(8)13/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | UFSYMUCXLSIFPL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene?
The IUPAC name of 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene (CID 169477157) is 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene.
What is the SMILES notation for 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene?
The canonical SMILES for 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene is Cc1cc(C=CCCl)cc(C)c1F.
What is the InChIKey of 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene?
The InChIKey is UFSYMUCXLSIFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF/c1-8-6-10(4-3-5-12)7-9(2)11(8)13/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene?
5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene has a molecular weight of 198.67 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloroprop-1-enyl)-2-fluoro-1,3-dimethylbenzene is sourced from PubChem (CID 169477157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).