C14H14N2O2S — CID 169479704
methyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enoate (PubChem CID 169479704) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is methyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 169479704 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(-c2nc(N)sc2C)cc1 |
| InChI | InChI=1S/C14H14N2O2S/c1-9-13(16-14(15)19-9)11-6-3-10(4-7-11)5-8-12(17)18-2/h3-8H,1-2H3,(H2,15,16) |
| InChIKey | PBGBFAGVUBDIBH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|