C11H12N2O3 — CID 169480330
ethyl 3-(6-carbamoyl-2-pyridinyl)prop-2-enoate (PubChem CID 169480330) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is ethyl 3-(6-carbamoyl-2-pyridinyl)prop-2-enoate.
| Compound Name | ethyl 3-(6-carbamoyl-2-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 169480330 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | ethyl 3-(6-carbamoyl-2-pyridinyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cccc(C(N)=O)n1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-16-10(14)7-6-8-4-3-5-9(13-8)11(12)15/h3-7H,2H2,1H3,(H2,12,15) |
| InChIKey | JRLXXVXWSCYAAQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|