C11H8F3NO4 — CID 169482651
4-(3-amino-3-oxoprop-1-enyl)-2-(trifluoromethoxy)benzoic acid (PubChem CID 169482651) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 4-(3-amino-3-oxoprop-1-enyl)-2-(trifluoromethoxy)benzoic acid.
| Compound Name | 4-(3-amino-3-oxoprop-1-enyl)-2-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 169482651 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-(3-amino-3-oxoprop-1-enyl)-2-(trifluoromethoxy)benzoic acid |
| SMILES | NC(=O)C=Cc1ccc(C(=O)O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F3NO4/c12-11(13,14)19-8-5-6(2-4-9(15)16)1-3-7(8)10(17)18/h1-5H,(H2,15,16)(H,17,18) |
| InChIKey | PYPQZAYXIWCBKV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|