About 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile
3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile (PubChem CID 169483562) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile |
| PubChem CID | 169483562 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile |
| SMILES | Cc1c(C=CC#N)cnc(N)c1N |
| InChI | InChI=1S/C9H10N4/c1-6-7(3-2-4-10)5-13-9(12)8(6)11/h2-3,5H,11H2,1H3,(H2,12,13) |
| InChIKey | IGTGUNZMMSGCIO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile?
The IUPAC name of 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile (CID 169483562) is 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile.
What is the SMILES notation for 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile?
The canonical SMILES for 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile is Cc1c(C=CC#N)cnc(N)c1N.
What is the InChIKey of 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile?
The InChIKey is IGTGUNZMMSGCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-6-7(3-2-4-10)5-13-9(12)8(6)11/h2-3,5H,11H2,1H3,(H2,12,13).
What are the key properties of 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile?
3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile has a molecular weight of 174.21 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-diamino-4-methyl-3-pyridinyl)prop-2-enenitrile is sourced from PubChem (CID 169483562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).