C8H6N6 — CID 169483639
3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile (PubChem CID 169483639) has the molecular formula C8H6N6 and a molecular weight of 186.18 g/mol. Its IUPAC name is 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile.
| Compound Name | 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169483639 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C8H6N6/c9-3-1-2-5-6-7(10)11-4-12-8(6)14-13-5/h1-2,4H,(H3,10,11,12,13,14) |
| InChIKey | FWPZQJGLFQOLDV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|