About 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile
3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile (PubChem CID 169483639) has the molecular formula C8H6N6
and a molecular weight of 186.18 g/mol. Its IUPAC name is 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile |
| PubChem CID | 169483639 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C8H6N6/c9-3-1-2-5-6-7(10)11-4-12-8(6)14-13-5/h1-2,4H,(H3,10,11,12,13,14) |
| InChIKey | FWPZQJGLFQOLDV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile?
The IUPAC name of 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile (CID 169483639) is 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile.
What is the SMILES notation for 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile?
The canonical SMILES for 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile is N#CC=Cc1[nH]nc2ncnc(N)c12.
What is the InChIKey of 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile?
The InChIKey is FWPZQJGLFQOLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N6/c9-3-1-2-5-6-7(10)11-4-12-8(6)14-13-5/h1-2,4H,(H3,10,11,12,13,14).
What are the key properties of 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile?
3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile has a molecular weight of 186.18 g/mol, XLogP of 0.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-2H-pyrazolo[3,4-d]pyrimidin-3-yl)prop-2-enenitrile is sourced from PubChem (CID 169483639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).