C10H12N2O — CID 169484976
3-(3,4-diamino-5-methylphenyl)prop-2-yn-1-ol (PubChem CID 169484976) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-(3,4-diamino-5-methylphenyl)prop-2-yn-1-ol.
| Compound Name | 3-(3,4-diamino-5-methylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169484976 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-(3,4-diamino-5-methylphenyl)prop-2-yn-1-ol |
| SMILES | Cc1cc(C#CCO)cc(N)c1N |
| InChI | InChI=1S/C10H12N2O/c1-7-5-8(3-2-4-13)6-9(11)10(7)12/h5-6,13H,4,11-12H2,1H3 |
| InChIKey | MSJKWGAJMDRBIV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|