About 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol
3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol (PubChem CID 169485141) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol |
| PubChem CID | 169485141 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol |
| SMILES | OCC#Cc1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C9H7N3O/c13-3-1-2-7-4-8-9(10-5-7)12-6-11-8/h4-6,13H,3H2,(H,10,11,12) |
| InChIKey | TUJXOBVFGDUSIP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol?
The IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol (CID 169485141) is 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol.
What is the SMILES notation for 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol?
The canonical SMILES for 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol is OCC#Cc1cnc2nc[nH]c2c1.
What is the InChIKey of 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol?
The InChIKey is TUJXOBVFGDUSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c13-3-1-2-7-4-8-9(10-5-7)12-6-11-8/h4-6,13H,3H2,(H,10,11,12).
What are the key properties of 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol?
3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol has a molecular weight of 173.17 g/mol, XLogP of 0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazo[4,5-b]pyridin-6-yl)prop-2-yn-1-ol is sourced from PubChem (CID 169485141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).