About 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one
6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 169485161) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 169485161 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2ncc(C#CCO)cc2o1 |
| InChI | InChI=1S/C9H6N2O3/c12-3-1-2-6-4-7-8(10-5-6)11-9(13)14-7/h4-5,12H,3H2,(H,10,11,13) |
| InChIKey | XXUKGUUPWGHRDZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 169485161) is 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is O=c1[nH]c2ncc(C#CCO)cc2o1.
What is the InChIKey of 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is XXUKGUUPWGHRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-3-1-2-6-4-7-8(10-5-6)11-9(13)14-7/h4-5,12H,3H2,(H,10,11,13).
What are the key properties of 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 190.16 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-hydroxyprop-1-ynyl)-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 169485161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).