C11H10O2S — CID 169486836
5-methyl-2-(3-sulfanylprop-1-ynyl)benzoic acid (PubChem CID 169486836) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-methyl-2-(3-sulfanylprop-1-ynyl)benzoic acid.
| Compound Name | 5-methyl-2-(3-sulfanylprop-1-ynyl)benzoic acid |
|---|---|
| PubChem CID | 169486836 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-methyl-2-(3-sulfanylprop-1-ynyl)benzoic acid |
| SMILES | Cc1ccc(C#CCS)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10O2S/c1-8-4-5-9(3-2-6-14)10(7-8)11(12)13/h4-5,7,14H,6H2,1H3,(H,12,13) |
| InChIKey | SIPVTEWHBUGGCB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|