C9H5F2NO2S — CID 169487212
3-(4,5-difluoro-2-nitrophenyl)prop-2-yne-1-thiol (PubChem CID 169487212) has the molecular formula C9H5F2NO2S and a molecular weight of 229.21 g/mol. Its IUPAC name is 3-(4,5-difluoro-2-nitrophenyl)prop-2-yne-1-thiol.
| Compound Name | 3-(4,5-difluoro-2-nitrophenyl)prop-2-yne-1-thiol |
|---|---|
| PubChem CID | 169487212 |
| Molecular Formula | C9H5F2NO2S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 3-(4,5-difluoro-2-nitrophenyl)prop-2-yne-1-thiol |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cc1C#CCS |
| InChI | InChI=1S/C9H5F2NO2S/c10-7-4-6(2-1-3-15)9(12(13)14)5-8(7)11/h4-5,15H,3H2 |
| InChIKey | WKODPCHHJFYAPC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|