C24H27NO4 — CID 169488047
tert-butyl N-[1-[(4E)-4-benzylidene-5-oxooxolan-2-yl]-2-phenylethyl]carbamate (PubChem CID 169488047) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl N-[1-[(4E)-4-benzylidene-5-oxooxolan-2-yl]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-[(4E)-4-benzylidene-5-oxooxolan-2-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 169488047 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl N-[1-[(4E)-4-benzylidene-5-oxooxolan-2-yl]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C1C/C(=C\c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C24H27NO4/c1-24(2,3)29-23(27)25-20(15-18-12-8-5-9-13-18)21-16-19(22(26)28-21)14-17-10-6-4-7-11-17/h4-14,20-21H,15-16H2,1-3H3,(H,25,27)/b19-14+ |
| InChIKey | NJSDDHGVLLHYSD-XMHGGMMESA-N |
| XLogP | 4.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|